CAS 951400-21-8 is the registry number for N-(2-(2,5-Dimethoxy-4-iodophenyl)ethyl)phthalimide-d6. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-[2-[4-iodo-2,5-bis(trideuteriomethoxy)phenyl]ethyl]isoindole-1,3-dione (CAS 951400-21-8) is a chemical compound with the molecular formula C18H16INO4 and a molecular weight of 443.3 g/mol. IUPAC name: 2-[2-[4-iodo-2,5-bis(trideuteriomethoxy)phenyl]ethyl]isoindole-1,3-dione. InChIKey: VYFSRYRSFYGKES-WFGJKAKNSA-N.
| Molecular formula | C18H16INO4 |
|---|---|
| Molecular weight | 443.3 g/mol |
| IUPAC name | 2-[2-[4-iodo-2,5-bis(trideuteriomethoxy)phenyl]ethyl]isoindole-1,3-dione |
| InChIKey | VYFSRYRSFYGKES-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=C(C=C1CCN2C(=O)C3=CC=CC=C3C2=O)OC([2H])([2H])[2H])I |
Computed by PubChem (NCBI)