CAS 951624-49-0 appears in our catalog under these names: Flupirtine Impurity 3, Flupirtine Impurity A, Flupirtine Impurity 1, 5-((4-Fluorobenzyl)amino)-1H-imidazo(4,5-b)pyridin-2(3H)-one. Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(4-fluorophenyl)methylamino]-1,3-dihydroimidazo[4,5-b]pyridin-2-one (CAS 951624-49-0) is a chemical compound with the molecular formula C13H11FN4O and a molecular weight of 258.25 g/mol. IUPAC name: 5-[(4-fluorophenyl)methylamino]-1,3-dihydroimidazo[4,5-b]pyridin-2-one. InChIKey: GEBXVBUWZIPSFP-UHFFFAOYSA-N.
| Molecular formula | C13H11FN4O |
|---|---|
| Molecular weight | 258.25 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methylamino]-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| InChIKey | GEBXVBUWZIPSFP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=NC3=C(C=C2)NC(=O)N3)F |
Computed by PubChem (NCBI)