CAS 951625-11-9 is the registry number for 2,5-Bis(trifluoromethyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,5-bis(trifluoromethyl)benzenesulfonamide (CAS 951625-11-9) is a chemical compound with the molecular formula C8H5F6NO2S and a molecular weight of 293.19 g/mol. IUPAC name: 2,5-bis(trifluoromethyl)benzenesulfonamide. InChIKey: KQNPHVUXUGXXCV-UHFFFAOYSA-N.
| Molecular formula | C8H5F6NO2S |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 2,5-bis(trifluoromethyl)benzenesulfonamide |
| InChIKey | KQNPHVUXUGXXCV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)