CAS 95166-16-8 is the registry number for 3-Methyl-1-trityl-1H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 5000mg, 10000mg.
3-methyl-1-trityl-1,2,4-triazole (CAS 95166-16-8) is a chemical compound with the molecular formula C22H19N3 and a molecular weight of 325.4 g/mol. IUPAC name: 3-methyl-1-trityl-1,2,4-triazole. InChIKey: UOBFFJSSRGNBFO-UHFFFAOYSA-N.
| Molecular formula | C22H19N3 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-methyl-1-trityl-1,2,4-triazole |
| InChIKey | UOBFFJSSRGNBFO-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=N1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)