CAS 951753-87-0 is the registry number for 5-Isothiocyanato-3-(trifluoromethyl)picolinonitrile, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
5-isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile (CAS 951753-87-0) is a chemical compound with the molecular formula C8H2F3N3S and a molecular weight of 229.18 g/mol. IUPAC name: 5-isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile. InChIKey: NQNLQGJLAVDALO-UHFFFAOYSA-N.
| Molecular formula | C8H2F3N3S |
|---|---|
| Molecular weight | 229.18 g/mol |
| IUPAC name | 5-isothiocyanato-3-(trifluoromethyl)pyridine-2-carbonitrile |
| InChIKey | NQNLQGJLAVDALO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)C#N)N=C=S |
Computed by PubChem (NCBI)