CAS 951884-03-0 appears in our catalog under these names: 2',7'-Dibromo-2-vinylspiro[cyclopropane-1,9'-fluorene], 95%, 2',7'-Dibromo-2-vinylspiro(cyclopropane-1,9'-fluorene), 95% mix TBC as stabilizer, 2',7'–Dibromo–2–vinylspiro(cyclopropane–1,9'–fluorene). Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2',7'-dibromo-2-ethenylspiro[cyclopropane-1,9'-fluorene] (CAS 951884-03-0) is a chemical compound with the molecular formula C17H12Br2 and a molecular weight of 376.1 g/mol. IUPAC name: 2',7'-dibromo-2-ethenylspiro[cyclopropane-1,9'-fluorene]. InChIKey: LZJYNJKWXMMBDE-UHFFFAOYSA-N.
| Molecular formula | C17H12Br2 |
|---|---|
| Molecular weight | 376.1 g/mol |
| IUPAC name | 2',7'-dibromo-2-ethenylspiro[cyclopropane-1,9'-fluorene] |
| InChIKey | LZJYNJKWXMMBDE-UHFFFAOYSA-N |
| SMILES | C=CC1CC12C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br |
Computed by PubChem (NCBI)