Products 951884-18-7
CAS 951884-18-7 is the registry number for N-Benzyl 2-bromo-5-fluorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-benzyl-2-bromo-5-fluorobenzamide (CAS 951884-18-7) is a chemical compound with the molecular formula C14H11BrFNO and a molecular weight of 308.14 g/mol. IUPAC name: N-benzyl-2-bromo-5-fluorobenzamide. InChIKey: BLCODIJJLWFIOY-UHFFFAOYSA-N.
| Molecular formula | C14H11BrFNO |
|---|---|
| Molecular weight | 308.14 g/mol |
| IUPAC name | N-benzyl-2-bromo-5-fluorobenzamide |
| InChIKey | BLCODIJJLWFIOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=C(C=CC(=C2)F)Br |
Computed by PubChem (NCBI)