Products 951885-58-8

CAS 951885-58-8 is the registry number for 2-(4-Bromobenzamido)ethyl 4-bromobenzoate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(4-bromobenzoyl)amino]ethyl 4-bromobenzoate (CAS 951885-58-8) is a chemical compound with the molecular formula C16H13Br2NO3 and a molecular weight of 427.09 g/mol. IUPAC name: 2-[(4-bromobenzoyl)amino]ethyl 4-bromobenzoate. InChIKey: WBXUMECQTYYWLO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13Br2NO3
Molecular weight427.09 g/mol
IUPAC name2-[(4-bromobenzoyl)amino]ethyl 4-bromobenzoate
InChIKeyWBXUMECQTYYWLO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)NCCOC(=O)C2=CC=C(C=C2)Br)Br

Computed by PubChem (NCBI)