CAS 951892-69-6 is the registry number for 4-(3,4-Difluorophenyl)-2-methyl-1-butene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-difluoro-4-(3-methylbut-3-enyl)benzene (CAS 951892-69-6) is a chemical compound with the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. IUPAC name: 1,2-difluoro-4-(3-methylbut-3-enyl)benzene. InChIKey: QWHUOJVURFKLSJ-UHFFFAOYSA-N.
| Molecular formula | C11H12F2 |
|---|---|
| Molecular weight | 182.21 g/mol |
| IUPAC name | 1,2-difluoro-4-(3-methylbut-3-enyl)benzene |
| InChIKey | QWHUOJVURFKLSJ-UHFFFAOYSA-N |
| SMILES | CC(=C)CCC1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)