CAS 951957-81-6 is the registry number for 3-(3,5-Difluorophenyl)-7-hydroxy-2h-chromen-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3,5-difluorophenyl)-7-hydroxychromen-2-one (CAS 951957-81-6) is a chemical compound with the molecular formula C15H8F2O3 and a molecular weight of 274.22 g/mol. IUPAC name: 3-(3,5-difluorophenyl)-7-hydroxychromen-2-one. InChIKey: NUOGQJJNVLNKAC-UHFFFAOYSA-N.
| Molecular formula | C15H8F2O3 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)-7-hydroxychromen-2-one |
| InChIKey | NUOGQJJNVLNKAC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C(=C2)C3=CC(=CC(=C3)F)F |
Computed by PubChem (NCBI)