CAS 952181-73-6 is the registry number for 2,2'-(2,5-Thiophenediylbis((E)-methylidynenitrilo))bisphenol. Offered by: TRC. Available pack sizes: 250mg.
2-[[5-[(2-hydroxyphenyl)iminomethyl]thiophen-2-yl]methylideneamino]phenol (CAS 952181-73-6) is a chemical compound with the molecular formula C18H14N2O2S and a molecular weight of 322.4 g/mol. IUPAC name: 2-[[5-[(2-hydroxyphenyl)iminomethyl]thiophen-2-yl]methylideneamino]phenol. InChIKey: RHJIOVOWEUNXJD-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O2S |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 2-[[5-[(2-hydroxyphenyl)iminomethyl]thiophen-2-yl]methylideneamino]phenol |
| InChIKey | RHJIOVOWEUNXJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=CC2=CC=C(S2)C=NC3=CC=CC=C3O)O |
Computed by PubChem (NCBI)