CAS 952412-99-6 appears in our catalog under these names: (R)-2-(1-hydroxybutyl)benzoic acid, Butylphthalide Impurity 41. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Potassium 2-(1-hydroxybutyl)benzoate (CAS 952412-99-6) is a chemical compound with the molecular formula C11H13KO3 and a molecular weight of 232.32 g/mol. IUPAC name: potassium 2-(1-hydroxybutyl)benzoate. InChIKey: FWVMFOCPTWNWFX-UHFFFAOYSA-M.
| Molecular formula | C11H13KO3 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | potassium 2-(1-hydroxybutyl)benzoate |
| InChIKey | FWVMFOCPTWNWFX-UHFFFAOYSA-M |
| SMILES | CCCC(C1=CC=CC=C1C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)