CAS 952483-64-6 is the registry number for (2S)-2-Bromo-4-carbamoylbutanoic Acid. Offered by: TRC. Available pack sizes: 250mg.
(2S)-5-amino-2-bromo-5-oxopentanoic acid (CAS 952483-64-6) is a chemical compound with the molecular formula C5H8BrNO3 and a molecular weight of 210.03 g/mol. IUPAC name: (2S)-5-amino-2-bromo-5-oxopentanoic acid. InChIKey: ZNWSKSMFEPWWGL-VKHMYHEASA-N.
| Molecular formula | C5H8BrNO3 |
|---|---|
| Molecular weight | 210.03 g/mol |
| IUPAC name | (2S)-5-amino-2-bromo-5-oxopentanoic acid |
| InChIKey | ZNWSKSMFEPWWGL-VKHMYHEASA-N |
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)Br |
Computed by PubChem (NCBI)