CAS 952584-86-0 appears in our catalog under these names: Mono-heptafluorobutyl fumarate, 95%, Mono-heptafluorobutyl fumarate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg.
(E)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-oxobut-2-enoic acid (CAS 952584-86-0) is a chemical compound with the molecular formula C8H5F7O4 and a molecular weight of 298.11 g/mol. IUPAC name: (E)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-oxobut-2-enoic acid. InChIKey: GAIGXXPLWNCDAG-OWOJBTEDSA-N.
| Molecular formula | C8H5F7O4 |
|---|---|
| Molecular weight | 298.11 g/mol |
| IUPAC name | (E)-4-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-oxobut-2-enoic acid |
| InChIKey | GAIGXXPLWNCDAG-OWOJBTEDSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)OC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)