CAS 952686-58-7 appears in our catalog under these names: Nitazoxanide Impurity 2, Nitazoxanide Impurity 3, 2-(((5-Nitro-2-thiazolyl)amino)carbonyl)phenyl 2-(acetyloxy)benzoate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-acetyloxybenzoate (CAS 952686-58-7) is a chemical compound with the molecular formula C19H13N3O7S and a molecular weight of 427.4 g/mol. IUPAC name: [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-acetyloxybenzoate. InChIKey: GNTFKOYJBMIACP-UHFFFAOYSA-N.
| Molecular formula | C19H13N3O7S |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] 2-acetyloxybenzoate |
| InChIKey | GNTFKOYJBMIACP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=CC=C1C(=O)OC2=CC=CC=C2C(=O)NC3=NC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)