CAS 952708-31-5 is the registry number for (1S,3R,4S)-3-(tert-butoxycarbonylamino)-4-hydroxy-cyclopentanecarboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3S,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 952708-31-5) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (1S,3S,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: LUFYOKRQPSBJIS-RNJXMRFFSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (1S,3S,4R)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | LUFYOKRQPSBJIS-RNJXMRFFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](C[C@@H]1O)C(=O)O |
Computed by PubChem (NCBI)