CAS 95271-89-9 appears in our catalog under these names: (R)-(+)-Coumachlor, (+)-Coumachlor. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
3-[(1R)-1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxychromen-2-one (CAS 95271-89-9) is a chemical compound with the molecular formula C19H15ClO4 and a molecular weight of 342.8 g/mol. IUPAC name: 3-[(1R)-1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxychromen-2-one. InChIKey: DEKWZWCFHUABHE-OAHLLOKOSA-N.
| Molecular formula | C19H15ClO4 |
|---|---|
| Molecular weight | 342.8 g/mol |
| IUPAC name | 3-[(1R)-1-(4-chlorophenyl)-3-oxobutyl]-4-hydroxychromen-2-one |
| InChIKey | DEKWZWCFHUABHE-OAHLLOKOSA-N |
| SMILES | CC(=O)C[C@H](C1=CC=C(C=C1)Cl)C2=C(C3=CC=CC=C3OC2=O)O |
Computed by PubChem (NCBI)