CAS 95335-91-4 is the registry number for D-Alpha,beta-cyclohexylideneglycerol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanol (CAS 95335-91-4) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: [(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanol. InChIKey: XUGYZVQSZWPABZ-QMMMGPOBSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | [(3S)-1,4-dioxaspiro[4.5]decan-3-yl]methanol |
| InChIKey | XUGYZVQSZWPABZ-QMMMGPOBSA-N |
| SMILES | C1CCC2(CC1)OC[C@@H](O2)CO |
Computed by PubChem (NCBI)