CAS 95343-86-5 is the registry number for α-D-Mannopyranosyl amine. Offered by: Biosynth. Available pack sizes: 250mg.
(2S,3S,4S,5S,6R)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 95343-86-5) is a chemical compound with the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. IUPAC name: (2S,3S,4S,5S,6R)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: WCWOEQFAYSXBRK-PQMKYFCFSA-N.
| Molecular formula | C6H13NO5 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (2S,3S,4S,5S,6R)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | WCWOEQFAYSXBRK-PQMKYFCFSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)N)O)O)O)O |
Computed by PubChem (NCBI)