CAS 953726-24-4 appears in our catalog under these names: 2-((2-Methoxyphenyl)amino)thieno(2,3-d)(1,3)thiazole-5-carboxylic acid, 95%, 2-((2-Methoxyphenyl)amino)thieno(2,3-d)(1,3)thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(2-methoxyanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid (CAS 953726-24-4) is a chemical compound with the molecular formula C13H10N2O3S2 and a molecular weight of 306.4 g/mol. IUPAC name: 2-(2-methoxyanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid. InChIKey: YSKAZJWAEFDVEV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3S2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 2-(2-methoxyanilino)thieno[2,3-d][1,3]thiazole-5-carboxylic acid |
| InChIKey | YSKAZJWAEFDVEV-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC2=NC3=C(S2)C=C(S3)C(=O)O |
Computed by PubChem (NCBI)