CAS 953744-05-3 is the registry number for 3-Amino-4-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-amino-4-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CAS 953744-05-3) is a chemical compound with the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. IUPAC name: 3-amino-4-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: QHYBLRCJPCPXCK-UHFFFAOYSA-N.
| Molecular formula | C12H13N3O2S |
|---|---|
| Molecular weight | 263.32 g/mol |
| IUPAC name | 3-amino-4-methoxy-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | QHYBLRCJPCPXCK-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=CC(=C(C=C2)OC)N |
Computed by PubChem (NCBI)