CAS 953778-58-0 appears in our catalog under these names: Suvecaltamide/ 99.29% (existing batch purity), MK–8998, MK-8998, 4-(1-Methylethyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]benzeneacetamide, 99.29% ,, 99.29% ,, Suvecaltamide, 99.96%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
2-(4-propan-2-ylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide (CAS 953778-58-0) is a chemical compound with the molecular formula C20H23F3N2O2 and a molecular weight of 380.4 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide. InChIKey: IQIKXZMPPBEWAD-CQSZACIVSA-N.
| Molecular formula | C20H23F3N2O2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
| InChIKey | IQIKXZMPPBEWAD-CQSZACIVSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)OCC(F)(F)F)NC(=O)CC2=CC=C(C=C2)C(C)C |
Computed by PubChem (NCBI)