Products 953778-63-7
CAS 953778-63-7 appears in our catalog under these names: TTA–A2, TTA-A2/ 99.9%, TTA-A2, (R)-2-(4-cyclopropylphenyl)-N-(1-(5-(2,2,2-trifluoroethoxy)pyridin-2-yl)ethyl)acetamide, TTA-A2, 99.33%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg.
2-(4-cyclopropylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide (CAS 953778-63-7) is a chemical compound with the molecular formula C20H21F3N2O2 and a molecular weight of 378.4 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide. InChIKey: GEYDMBNDOVPFJL-CYBMUJFWSA-N.
| Molecular formula | C20H21F3N2O2 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-(4-cyclopropylphenyl)-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]acetamide |
| InChIKey | GEYDMBNDOVPFJL-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)OCC(F)(F)F)NC(=O)CC2=CC=C(C=C2)C3CC3 |
Computed by PubChem (NCBI)