CAS 953780-70-6 appears in our catalog under these names: (R)-1-(5-Bromopyridin-2-yl)ethanamine hydrochloride, 97%, (R)–1–(5–Bromopyridin–2–yl)ethanamine hydrochloride, (R)-1-(5-Bromopyridin-2-yl)ethanamine hydrochloride, 97%, 97%, (R)-1-(5-Bromopyridin-2-yl)ethan-1-amine hydrochloride, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg.
(1R)-1-(5-bromo-2-pyridinyl)ethanamine;hydrochloride (CAS 953780-70-6) is a chemical compound with the molecular formula C7H10BrClN2 and a molecular weight of 237.52 g/mol. IUPAC name: (1R)-1-(5-bromo-2-pyridinyl)ethanamine;hydrochloride. InChIKey: KSGKDUJWJNDXCO-NUBCRITNSA-N.
| Molecular formula | C7H10BrClN2 |
|---|---|
| Molecular weight | 237.52 g/mol |
| IUPAC name | (1R)-1-(5-bromo-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | KSGKDUJWJNDXCO-NUBCRITNSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)