CAS 953907-60-3 is the registry number for 2–(2–Bromophenyl)–4–(chloromethyl)–1,3–thiazole. Offered by: GLPBio. Available pack sizes: 100mg.
2-(2-bromophenyl)-4-(chloromethyl)-1,3-thiazole (CAS 953907-60-3) is a chemical compound with the molecular formula C10H7BrClNS and a molecular weight of 288.59 g/mol. IUPAC name: 2-(2-bromophenyl)-4-(chloromethyl)-1,3-thiazole. InChIKey: GNBSSNABAIZHKN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClNS |
|---|---|
| Molecular weight | 288.59 g/mol |
| IUPAC name | 2-(2-bromophenyl)-4-(chloromethyl)-1,3-thiazole |
| InChIKey | GNBSSNABAIZHKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)CCl)Br |
Computed by PubChem (NCBI)