Products 954-27-8

CAS 954-27-8 is the registry number for 4-Pyridoxic Acid 5-Phosphate. Offered by: Chemat Brand. Available pack sizes: on request.

3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid (CAS 954-27-8) is a chemical compound with the molecular formula C8H10NO7P and a molecular weight of 263.14 g/mol. IUPAC name: 3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid. InChIKey: FTQNPJLEFOEFIU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10NO7P
Molecular weight263.14 g/mol
IUPAC name3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid
InChIKeyFTQNPJLEFOEFIU-UHFFFAOYSA-N
SMILESCC1=NC=C(C(=C1O)C(=O)O)COP(=O)(O)O

Computed by PubChem (NCBI)