CAS 954-27-8 is the registry number for 4-Pyridoxic Acid 5-Phosphate. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid (CAS 954-27-8) is a chemical compound with the molecular formula C8H10NO7P and a molecular weight of 263.14 g/mol. IUPAC name: 3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid. InChIKey: FTQNPJLEFOEFIU-UHFFFAOYSA-N.
| Molecular formula | C8H10NO7P |
|---|---|
| Molecular weight | 263.14 g/mol |
| IUPAC name | 3-hydroxy-2-methyl-5-(phosphonooxymethyl)pyridine-4-carboxylic acid |
| InChIKey | FTQNPJLEFOEFIU-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C(=C1O)C(=O)O)COP(=O)(O)O |
Computed by PubChem (NCBI)