CAS 954126-98-8 appears in our catalog under these names: Danirixin/ 98%, Danirixin 98+%, Urea, N-[4-chloro-2-hydroxy-3-[(3S)-3-piperidinylsulfonyl]phenyl]-N'-(3-fluoro-2-methylphenyl)-, 98+%, 98+%, Danirixin (GSK1325756), Danirixin. Offered by: TargetMol, Ambeed, Chemat, Chemat Brand, GLPBio. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, on request, 1 mg.
1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(3-fluoro-2-methylphenyl)urea (CAS 954126-98-8) is a chemical compound with the molecular formula C19H21ClFN3O4S and a molecular weight of 441.9 g/mol. IUPAC name: 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(3-fluoro-2-methylphenyl)urea. InChIKey: NGYNBSHYFOFVLS-LBPRGKRZSA-N.
| Molecular formula | C19H21ClFN3O4S |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 1-[4-chloro-2-hydroxy-3-[(3S)-piperidin-3-yl]sulfonylphenyl]-3-(3-fluoro-2-methylphenyl)urea |
| InChIKey | NGYNBSHYFOFVLS-LBPRGKRZSA-N |
| SMILES | CC1=C(C=CC=C1F)NC(=O)NC2=C(C(=C(C=C2)Cl)S(=O)(=O)[C@H]3CCCNC3)O |
Computed by PubChem (NCBI)