CAS 95413-92-6 is the registry number for 2-Chloro-3,4-Dimethoxyphenethylamine Hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(2-chloro-3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 95413-92-6) is a chemical compound with the molecular formula C10H15Cl2NO2 and a molecular weight of 252.13 g/mol. IUPAC name: 2-(2-chloro-3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PMTBLRKLMNAJQI-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2NO2 |
|---|---|
| Molecular weight | 252.13 g/mol |
| IUPAC name | 2-(2-chloro-3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PMTBLRKLMNAJQI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCN)Cl)OC.Cl |
Computed by PubChem (NCBI)