CAS 95415-84-2 is the registry number for Gramine-alpha,alpha-d2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 95415-84-2) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 176.25 g/mol. IUPAC name: 1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: OCDGBSUVYYVKQZ-MGVXTIMCSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine |
| InChIKey | OCDGBSUVYYVKQZ-MGVXTIMCSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=CC=CC=C21)N(C)C |
Computed by PubChem (NCBI)