Products 95415-84-2

CAS 95415-84-2 is the registry number for Gramine-alpha,alpha-d2, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine (CAS 95415-84-2) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 176.25 g/mol. IUPAC name: 1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine. InChIKey: OCDGBSUVYYVKQZ-MGVXTIMCSA-N.

Identity
Molecular formulaC11H14N2
Molecular weight176.25 g/mol
IUPAC name1,1-dideuterio-1-(1H-indol-3-yl)-N,N-dimethylmethanamine
InChIKeyOCDGBSUVYYVKQZ-MGVXTIMCSA-N
SMILES[2H]C([2H])(C1=CNC2=CC=CC=C21)N(C)C

Computed by PubChem (NCBI)