CAS 954231-30-2 appears in our catalog under these names: 4-(3-Bromophenyl)-2,6-dichloro-5-methylpyrimidine, 95%, 4-(3-Bromophenyl)-2,6-dichloro-5-methylpyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(3-bromophenyl)-2,6-dichloro-5-methylpyrimidine (CAS 954231-30-2) is a chemical compound with the molecular formula C11H7BrCl2N2 and a molecular weight of 317.99 g/mol. IUPAC name: 4-(3-bromophenyl)-2,6-dichloro-5-methylpyrimidine. InChIKey: XMQQXAVXWHXVQE-UHFFFAOYSA-N.
| Molecular formula | C11H7BrCl2N2 |
|---|---|
| Molecular weight | 317.99 g/mol |
| IUPAC name | 4-(3-bromophenyl)-2,6-dichloro-5-methylpyrimidine |
| InChIKey | XMQQXAVXWHXVQE-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1Cl)Cl)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)