CAS 954240-38-1 is the registry number for 1-Boc-4-(1-oxo-indan-5-yl)-piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Tert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate (CAS 954240-38-1) is a chemical compound with the molecular formula C18H24N2O3 and a molecular weight of 316.4 g/mol. IUPAC name: tert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate. InChIKey: LUWGZJCGXBUFFM-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | tert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate |
| InChIKey | LUWGZJCGXBUFFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC3=C(C=C2)C(=O)CC3 |
Computed by PubChem (NCBI)