Products 954240-38-1

CAS 954240-38-1 is the registry number for 1-Boc-4-(1-oxo-indan-5-yl)-piperazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate (CAS 954240-38-1) is a chemical compound with the molecular formula C18H24N2O3 and a molecular weight of 316.4 g/mol. IUPAC name: tert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate. InChIKey: LUWGZJCGXBUFFM-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O3
Molecular weight316.4 g/mol
IUPAC nametert-butyl 4-(1-oxo-2,3-dihydroinden-5-yl)piperazine-1-carboxylate
InChIKeyLUWGZJCGXBUFFM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=CC3=C(C=C2)C(=O)CC3

Computed by PubChem (NCBI)