CAS 954263-08-2 appears in our catalog under these names: 2-(6-(Ethanesulfonyl)-2-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetic acid, 2-(6-(Ethanesulfonyl)-2-oxo-3,4-dihydro-2H-1,4-benzoxazin-4-yl)acetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(6-ethylsulfonyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetic acid (CAS 954263-08-2) is a chemical compound with the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. IUPAC name: 2-(6-ethylsulfonyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetic acid. InChIKey: SDKNKZPGBPJDKR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6S |
|---|---|
| Molecular weight | 299.30 g/mol |
| IUPAC name | 2-(6-ethylsulfonyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetic acid |
| InChIKey | SDKNKZPGBPJDKR-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC2=C(C=C1)OC(=O)CN2CC(=O)O |
Computed by PubChem (NCBI)