CAS 954382-23-1 is the registry number for 5-(tert-Butyl)-3-(tert-butyldimethylsilyl)-2-hydroxybenzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-tert-butyl-3-[tert-butyl(dimethyl)silyl]-2-hydroxybenzaldehyde (CAS 954382-23-1) is a chemical compound with the molecular formula C17H28O2Si and a molecular weight of 292.5 g/mol. IUPAC name: 5-tert-butyl-3-[tert-butyl(dimethyl)silyl]-2-hydroxybenzaldehyde. InChIKey: NOZBITYJQBGRPN-UHFFFAOYSA-N.
| Molecular formula | C17H28O2Si |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | 5-tert-butyl-3-[tert-butyl(dimethyl)silyl]-2-hydroxybenzaldehyde |
| InChIKey | NOZBITYJQBGRPN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)[Si](C)(C)C(C)(C)C)O)C=O |
Computed by PubChem (NCBI)