Products 954416-67-2
CAS 954416-67-2 is the registry number for 6BrCaQ. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(6-bromo-1-methyl-2-oxoquinolin-3-yl)-4-methoxybenzamide (CAS 954416-67-2) is a chemical compound with the molecular formula C18H15BrN2O3 and a molecular weight of 387.2 g/mol. IUPAC name: N-(6-bromo-1-methyl-2-oxoquinolin-3-yl)-4-methoxybenzamide. InChIKey: RCKMJRZPGJEVGF-UHFFFAOYSA-N.
| Molecular formula | C18H15BrN2O3 |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | N-(6-bromo-1-methyl-2-oxoquinolin-3-yl)-4-methoxybenzamide |
| InChIKey | RCKMJRZPGJEVGF-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C=C(C1=O)NC(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)
Synonyms:
6BrCaQ, orb1688310