CAS 95473-30-6 appears in our catalog under these names: Methyl 2-(N-carbamoylsulfamoyl)benzoate, 98%, Methyl 2-(((aminocarbonyl)amino)sulfonyl)benzoate, 2-(Carbamoylsulfamoyl)benzoic acid methyl ester, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: AmBeed, Biosynth, HPC Standards. Available pack sizes: 1g, 0,5g, 50mg, 1x1ml.
Methyl 2-(carbamoylsulfamoyl)benzoate (CAS 95473-30-6) is a chemical compound with the molecular formula C9H10N2O5S and a molecular weight of 258.25 g/mol. IUPAC name: methyl 2-(carbamoylsulfamoyl)benzoate. InChIKey: SRCPGSKDFKGYHP-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5S |
|---|---|
| Molecular weight | 258.25 g/mol |
| IUPAC name | methyl 2-(carbamoylsulfamoyl)benzoate |
| InChIKey | SRCPGSKDFKGYHP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)N |
Computed by PubChem (NCBI)