CAS 95480-61-8 appears in our catalog under these names: Eugenol-glucuronide, Eugenol-β-D-glucuronide. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg, 100mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methoxy-4-prop-2-enylphenoxy)oxane-2-carboxylic acid (CAS 95480-61-8) is a chemical compound with the molecular formula C16H20O8 and a molecular weight of 340.32 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methoxy-4-prop-2-enylphenoxy)oxane-2-carboxylic acid. InChIKey: MQXZRKSWEMEXCG-JHZZJYKESA-N.
| Molecular formula | C16H20O8 |
|---|---|
| Molecular weight | 340.32 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-methoxy-4-prop-2-enylphenoxy)oxane-2-carboxylic acid |
| InChIKey | MQXZRKSWEMEXCG-JHZZJYKESA-N |
| SMILES | COC1=C(C=CC(=C1)CC=C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O |
Computed by PubChem (NCBI)