Products 95501-60-3
CAS 95501-60-3 appears in our catalog under these names: Benzyl L-valyl-L-prolinate hydrochloride, 97%, 97%, Benzyl L-valyl-L-prolinate hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Benzyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride (CAS 95501-60-3) is a chemical compound with the molecular formula C17H25ClN2O3 and a molecular weight of 340.8 g/mol. IUPAC name: benzyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride. InChIKey: ARJYSUOEAKFRQU-YYLIZZNMSA-N.
| Molecular formula | C17H25ClN2O3 |
|---|---|
| Molecular weight | 340.8 g/mol |
| IUPAC name | benzyl (2S)-1-[(2S)-2-amino-3-methylbutanoyl]pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | ARJYSUOEAKFRQU-YYLIZZNMSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)