CAS 955121-20-7 appears in our catalog under these names: Perylene–3–boronic acid, Perylen-3-ylboronic acid 95%, (perylen-3-yl)boronicacid, 95%, 95%, (Perylen-3-yl)boronic acid, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Perylen-3-ylboronic acid (CAS 955121-20-7) is a chemical compound with the molecular formula C20H13BO2 and a molecular weight of 296.1 g/mol. IUPAC name: perylen-3-ylboronic acid. InChIKey: CHFSSIZYLDGLQR-UHFFFAOYSA-N.
| Molecular formula | C20H13BO2 |
|---|---|
| Molecular weight | 296.1 g/mol |
| IUPAC name | perylen-3-ylboronic acid |
| InChIKey | CHFSSIZYLDGLQR-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C3C2=C(C=C1)C4=CC=CC5=C4C3=CC=C5)(O)O |
Computed by PubChem (NCBI)