Products 955376-42-8
CAS 955376-42-8 is the registry number for MeS-IMPY. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,N-dimethyl-4-(6-methylsulfanylimidazo[1,2-a]pyridin-2-yl)aniline (CAS 955376-42-8) is a chemical compound with the molecular formula C16H17N3S and a molecular weight of 283.4 g/mol. IUPAC name: N,N-dimethyl-4-(6-methylsulfanylimidazo[1,2-a]pyridin-2-yl)aniline. InChIKey: WOYCDVDURLTMAW-UHFFFAOYSA-N.
| Molecular formula | C16H17N3S |
|---|---|
| Molecular weight | 283.4 g/mol |
| IUPAC name | N,N-dimethyl-4-(6-methylsulfanylimidazo[1,2-a]pyridin-2-yl)aniline |
| InChIKey | WOYCDVDURLTMAW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CN3C=C(C=CC3=N2)SC |
Computed by PubChem (NCBI)