CAS 955404-04-3 appears in our catalog under these names: Bedaquiline Impurity 35, N- Didesmethyl Bedaquiline. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(1R,2S)-4-amino-1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-1-yl-1-phenylbutan-2-ol (CAS 955404-04-3) is a chemical compound with the molecular formula C30H27BrN2O2 and a molecular weight of 527.4 g/mol. IUPAC name: (1R,2S)-4-amino-1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-1-yl-1-phenylbutan-2-ol. InChIKey: NJEYEDSQSKSUQT-PQHLKRTFSA-N.
| Molecular formula | C30H27BrN2O2 |
|---|---|
| Molecular weight | 527.4 g/mol |
| IUPAC name | (1R,2S)-4-amino-1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| InChIKey | NJEYEDSQSKSUQT-PQHLKRTFSA-N |
| SMILES | COC1=C(C=C2C=C(C=CC2=N1)Br)[C@@H](C3=CC=CC=C3)[C@@](CCN)(C4=CC=CC5=CC=CC=C54)O |
Computed by PubChem (NCBI)