CAS 955959-91-8 is the registry number for 4-(4-Dibenzofuranyl)-N-[4-(4-dibenzofuranyl)phenyl]benzenamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-dibenzofuran-4-yl-N-(4-dibenzofuran-4-ylphenyl)aniline (CAS 955959-91-8) is a chemical compound with the molecular formula C36H23NO2 and a molecular weight of 501.6 g/mol. IUPAC name: 4-dibenzofuran-4-yl-N-(4-dibenzofuran-4-ylphenyl)aniline. InChIKey: DOFCFQWRYGGAKK-UHFFFAOYSA-N.
| Molecular formula | C36H23NO2 |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 4-dibenzofuran-4-yl-N-(4-dibenzofuran-4-ylphenyl)aniline |
| InChIKey | DOFCFQWRYGGAKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=C(C=C4)NC5=CC=C(C=C5)C6=CC=CC7=C6OC8=CC=CC=C78 |
Computed by PubChem (NCBI)