Products 95596-35-3
CAS 95596-35-3 appears in our catalog under these names: 1,5-Pentane-1,1,5,5-d4-diamine, >95% (GC), 1,5-Pentane-1,1,5,5-d4-diamine, 98 atom % D, min 98% Chemical Purity, D4-1,5-Diaminopentane. Offered by: TRC, CDN, HPC Standards. Available pack sizes: 10mg, 1mg, 5mg, 0,1g, 0,05g, 1x10mg.
1,1,5,5-tetradeuteriopentane-1,5-diamine (CAS 95596-35-3) is a chemical compound with the molecular formula C5H14N2 and a molecular weight of 106.20 g/mol. IUPAC name: 1,1,5,5-tetradeuteriopentane-1,5-diamine. InChIKey: VHRGRCVQAFMJIZ-CQOLUAMGSA-N.
| Molecular formula | C5H14N2 |
|---|---|
| Molecular weight | 106.20 g/mol |
| IUPAC name | 1,1,5,5-tetradeuteriopentane-1,5-diamine |
| InChIKey | VHRGRCVQAFMJIZ-CQOLUAMGSA-N |
| SMILES | [2H]C([2H])(CCCC([2H])([2H])N)N |
Computed by PubChem (NCBI)