CAS 955978-75-3 appears in our catalog under these names: 4-Bromo-2-(trifluoromethyl)-1h-indole, 97%, 4-Bromo-2-(trifluoromethyl)indole, 98%, 4-Bromo-2-(trifluoromethyl)-1H-indole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
4-bromo-2-(trifluoromethyl)-1H-indole (CAS 955978-75-3) is a chemical compound with the molecular formula C9H5BrF3N and a molecular weight of 264.04 g/mol. IUPAC name: 4-bromo-2-(trifluoromethyl)-1H-indole. InChIKey: BALLXZBCVCULJE-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3N |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | 4-bromo-2-(trifluoromethyl)-1H-indole |
| InChIKey | BALLXZBCVCULJE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(N2)C(F)(F)F)C(=C1)Br |
Computed by PubChem (NCBI)