CAS 955993-19-8 is the registry number for 2-((6-Chloro-1,2,3,4-tetrahydroacridin-9-yl)amino)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethanol (CAS 955993-19-8) is a chemical compound with the molecular formula C15H17ClN2O and a molecular weight of 276.76 g/mol. IUPAC name: 2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethanol. InChIKey: FXFMPZYOVUCHLP-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2O |
|---|---|
| Molecular weight | 276.76 g/mol |
| IUPAC name | 2-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]ethanol |
| InChIKey | FXFMPZYOVUCHLP-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C=CC(=C3)Cl)C(=C2C1)NCCO |
Computed by PubChem (NCBI)