CAS 955997-89-4 appears in our catalog under these names: 4-Isobutoxybenzylamine Acetate, (4-Isobutoxyphenyl)methanamine acetate 98%, (4-Isobutoxyphenyl)methanamine acetate, 98%, (4-Isobutoxyphenyl)methanamine acetate, 98%, 98%, Pimavanserin Impurity 2 Acetate. Offered by: TRC, Ambeed, Fluorochem, Chemat, Chemat Brand. Available pack sizes: 100mg, 1g, 5g, 25g, 100g, on request.
Acetic acid;[4-(2-methylpropoxy)phenyl]methanamine (CAS 955997-89-4) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: acetic acid;[4-(2-methylpropoxy)phenyl]methanamine. InChIKey: VPEGFBXWSGBVDN-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | acetic acid;[4-(2-methylpropoxy)phenyl]methanamine |
| InChIKey | VPEGFBXWSGBVDN-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC=C(C=C1)CN.CC(=O)O |
Computed by PubChem (NCBI)