CAS 956136-98-4 appears in our catalog under these names: Pradigastat Sodium, Pradigastat (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, Get quote.
Sodium 2-[4-[4-[5-[[6-(trifluoromethyl)-3-pyridinyl]amino]-2-pyridinyl]phenyl]cyclohexyl]acetate (CAS 956136-98-4) is a chemical compound with the molecular formula C25H23F3N3NaO2 and a molecular weight of 477.5 g/mol. IUPAC name: sodium 2-[4-[4-[5-[[6-(trifluoromethyl)-3-pyridinyl]amino]-2-pyridinyl]phenyl]cyclohexyl]acetate. InChIKey: MUZRGKSNUTWRAF-UHFFFAOYSA-M.
| Molecular formula | C25H23F3N3NaO2 |
|---|---|
| Molecular weight | 477.5 g/mol |
| IUPAC name | sodium 2-[4-[4-[5-[[6-(trifluoromethyl)-3-pyridinyl]amino]-2-pyridinyl]phenyl]cyclohexyl]acetate |
| InChIKey | MUZRGKSNUTWRAF-UHFFFAOYSA-M |
| SMILES | C1CC(CCC1CC(=O)[O-])C2=CC=C(C=C2)C3=NC=C(C=C3)NC4=CN=C(C=C4)C(F)(F)F.[Na+] |
Computed by PubChem (NCBI)