CAS 95630-78-7 is the registry number for Diexo-(3-amino-bicyclo[2.2.1]hept-5-en-2-yl)-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
[(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol (CAS 95630-78-7) is a chemical compound with the molecular formula C8H13NO and a molecular weight of 139.19 g/mol. IUPAC name: [(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol. InChIKey: PDEGCYLJROJFDB-OSMVPFSASA-N.
| Molecular formula | C8H13NO |
|---|---|
| Molecular weight | 139.19 g/mol |
| IUPAC name | [(1R,2R,3S,4S)-3-amino-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| InChIKey | PDEGCYLJROJFDB-OSMVPFSASA-N |
| SMILES | C1[C@@H]2C=C[C@H]1[C@@H]([C@@H]2CO)N |
Computed by PubChem (NCBI)