CAS 95632-46-5 appears in our catalog under these names: Suc-Ala-Pro-pNA, Suc–Ala–Pro–pNA, Suc-Ala-Pro-pNA, 99.03%. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 250mg, 50mg, 100mg, 10 mg, 5 mg.
4-[[(2S)-1-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (CAS 95632-46-5) is a chemical compound with the molecular formula C18H22N4O7 and a molecular weight of 406.4 g/mol. IUPAC name: 4-[[(2S)-1-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: ODADHBYAFURJLG-FZMZJTMJSA-N.
| Molecular formula | C18H22N4O7 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 4-[[(2S)-1-[(2S)-2-[(4-nitrophenyl)carbamoyl]pyrrolidin-1-yl]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | ODADHBYAFURJLG-FZMZJTMJSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)