CAS 956354-02-2 appears in our catalog under these names: (2E)-3-[1-Benzyl-3-(3,4-dimethylphenyl)-1h-pyrazol-4-yl]acrylic acid, 95%, (2E)-3-(1-Benzyl-3-(3,4-dimethylphenyl)-1H-pyrazol-4-yl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(E)-3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]prop-2-enoic acid (CAS 956354-02-2) is a chemical compound with the molecular formula C21H20N2O2 and a molecular weight of 332.4 g/mol. IUPAC name: (E)-3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]prop-2-enoic acid. InChIKey: LNCGEFSSDWFMHK-ZHACJKMWSA-N.
| Molecular formula | C21H20N2O2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (E)-3-[1-benzyl-3-(3,4-dimethylphenyl)pyrazol-4-yl]prop-2-enoic acid |
| InChIKey | LNCGEFSSDWFMHK-ZHACJKMWSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NN(C=C2/C=C/C(=O)O)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)