CAS 956373-04-9 appears in our catalog under these names: 9-(4-tert-Butylphenyl)-3,6-ditrityl-9H-carbazole, 99%, Poly(9,9-n-dihexyl-2,7-fluorene-alt-9-phenyl-3,6-carbazole). Offered by: Lumtec. Available pack sizes: 1g, 5g, On request.
9-(4-tert-butylphenyl)-3,6-ditritylcarbazole (CAS 956373-04-9) is a chemical compound with the molecular formula C60H49N and a molecular weight of 784.0 g/mol. IUPAC name: 9-(4-tert-butylphenyl)-3,6-ditritylcarbazole. InChIKey: XUPHFLNNUVKICJ-UHFFFAOYSA-N.
| Molecular formula | C60H49N |
|---|---|
| Molecular weight | 784.0 g/mol |
| IUPAC name | 9-(4-tert-butylphenyl)-3,6-ditritylcarbazole |
| InChIKey | XUPHFLNNUVKICJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)C7=C2C=CC(=C7)C(C8=CC=CC=C8)(C9=CC=CC=C9)C1=CC=CC=C1 |
Computed by PubChem (NCBI)